Simplify sin(25)cos(35)+cos(25)sin(35)
Problem
Solution
Identify the trigonometric identity that matches the structure of the expression. The expression follows the form
sin(A)*cos(B)+cos(A)*sin(B) Recall the sine addition formula, which states that
sin(A+B)=sin(A)*cos(B)+cos(A)*sin(B) Substitute the given values
A=25 andB=35 into the identity.
Add the angles inside the sine function.
Evaluate the resulting trigonometric value using the unit circle or special triangles.
Final Answer
Want more problems? Check here!