Simplify sin(20)cos(10)+cos(20)sin(10)
Problem
Solution
Identify the trigonometric identity that matches the structure of the expression.
Apply the sine addition formula, which states
sin(A+B)=sin(A)*cos(B)+cos(A)*sin(B) Substitute the values
A=20 andB=10 into the formula.Simplify the expression by adding the angles inside the sine function.
Evaluate the resulting trigonometric value.
Final Answer
Want more problems? Check here!