Simplify cos(pi/7)cos(pi/5)-sin(pi/7)sin(pi/5)
Problem
Solution
Identify the trigonometric identity that matches the structure of the expression. The expression follows the form
cos(A)*cos(B)−sin(A)*sin(B) Recall the cosine addition formula, which states:
Assign the values for
A andB from the given expression:
Apply the formula by substituting
A andB into the cosine sum identity:
Find a common denominator for the fractions inside the cosine function. The least common multiple of
7 and5 is35
Add the fractions:
Final Answer
Want more problems? Check here!