Simplify cos(20)cos(70)-sin(20)sin(70)
Problem
Solution
Identify the trigonometric identity that matches the structure of the expression. The expression follows the form
cos(A)*cos(B)−sin(A)*sin(B) Apply the formula for the cosine of a sum of two angles, which states
cos(A+B)=cos(A)*cos(B)−sin(A)*sin(B) Substitute the given values
A=20 andB=70 into the identity.
Simplify the sum inside the parentheses.
Evaluate the cosine of
90 using the unit circle or known trigonometric values.
Final Answer
Want more problems? Check here!